C13H16N2O7S3 — CID 130281860
1-(2-hydroxy-5-oxopyrrolidin-1-yl)oxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid (PubChem CID 130281860) has the molecular formula C13H16N2O7S3 and a molecular weight of 408.48 g/mol. Its IUPAC name is 1-(2-hydroxy-5-oxopyrrolidin-1-yl)oxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid.
| Compound Name | 1-(2-hydroxy-5-oxopyrrolidin-1-yl)oxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 130281860 |
| Molecular Formula | C13H16N2O7S3 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 1-(2-hydroxy-5-oxopyrrolidin-1-yl)oxy-1-oxo-4-(pyridin-2-yldisulfanyl)butane-2-sulfonic acid |
| SMILES | O=C(ON1C(=O)CCC1O)C(CCSSc1ccccn1)S(=O)(=O)O |
| InChI | InChI=1S/C13H16N2O7S3/c16-11-4-5-12(17)15(11)22-13(18)9(25(19,20)21)6-8-23-24-10-3-1-2-7-14-10/h1-3,7,9,11,16H,4-6,8H2,(H,19,20,21) |
| InChIKey | KVLOPYDCHBXKTN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|