C12H12N2O7S3 — CID 172700614
2-(2,5-dioxopyrrolidin-1-yl)-3-(pyridin-2-yldisulfanyl)-2-sulfopropanoic acid (PubChem CID 172700614) has the molecular formula C12H12N2O7S3 and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-3-(pyridin-2-yldisulfanyl)-2-sulfopropanoic acid.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-3-(pyridin-2-yldisulfanyl)-2-sulfopropanoic acid |
|---|---|
| PubChem CID | 172700614 |
| Molecular Formula | C12H12N2O7S3 |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-3-(pyridin-2-yldisulfanyl)-2-sulfopropanoic acid |
| SMILES | O=C1CCC(=O)N1C(CSSc1ccccn1)(C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C12H12N2O7S3/c15-9-4-5-10(16)14(9)12(11(17)18,24(19,20)21)7-22-23-8-3-1-2-6-13-8/h1-3,6H,4-5,7H2,(H,17,18)(H,19,20,21) |
| InChIKey | CXJRHRUDOIGDBU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|