C18H21N3O3S4 — CID 175837537
2-[bis[2-(pyridin-2-yldisulfanyl)ethyl]amino]-4-oxobutanoic acid (PubChem CID 175837537) has the molecular formula C18H21N3O3S4 and a molecular weight of 455.65 g/mol. Its IUPAC name is 2-[bis[2-(pyridin-2-yldisulfanyl)ethyl]amino]-4-oxobutanoic acid.
| Compound Name | 2-[bis[2-(pyridin-2-yldisulfanyl)ethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175837537 |
| Molecular Formula | C18H21N3O3S4 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 2-[bis[2-(pyridin-2-yldisulfanyl)ethyl]amino]-4-oxobutanoic acid |
| SMILES | O=CCC(C(=O)O)N(CCSSc1ccccn1)CCSSc1ccccn1 |
| InChI | InChI=1S/C18H21N3O3S4/c22-12-7-15(18(23)24)21(10-13-25-27-16-5-1-3-8-19-16)11-14-26-28-17-6-2-4-9-20-17/h1-6,8-9,12,15H,7,10-11,13-14H2,(H,23,24) |
| InChIKey | KWJAPMPOAOUFLO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|