About [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate
[formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate (PubChem CID 143394194) has the molecular formula C10H12N2O3S2
and a molecular weight of 272.35 g/mol. Its IUPAC name is [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate.
Molecular Properties
| Compound Name | [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate |
| PubChem CID | 143394194 |
| Molecular Formula | C10H12N2O3S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate |
| SMILES | CN(C=O)OC(=O)CCSSc1ccccn1 |
| InChI | InChI=1S/C10H12N2O3S2/c1-12(8-13)15-10(14)5-7-16-17-9-4-2-3-6-11-9/h2-4,6,8H,5,7H2,1H3 |
| InChIKey | VKDMBLLCAMIZIL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate?
The IUPAC name of [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate (CID 143394194) is [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate.
What is the SMILES notation for [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate?
The canonical SMILES for [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate is CN(C=O)OC(=O)CCSSc1ccccn1.
What is the InChIKey of [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate?
The InChIKey is VKDMBLLCAMIZIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3S2/c1-12(8-13)15-10(14)5-7-16-17-9-4-2-3-6-11-9/h2-4,6,8H,5,7H2,1H3.
What are the key properties of [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate?
[formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate has a molecular weight of 272.35 g/mol, XLogP of 1.76, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [formyl(methyl)amino] 3-(pyridin-2-yldisulfanyl)propanoate is sourced from PubChem (CID 143394194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).