C13H18N2O3S2 — CID 129092686
methyl 4-[3-(pyridin-2-yldisulfanyl)propanoylamino]butanoate (PubChem CID 129092686) has the molecular formula C13H18N2O3S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is methyl 4-[3-(pyridin-2-yldisulfanyl)propanoylamino]butanoate.
| Compound Name | methyl 4-[3-(pyridin-2-yldisulfanyl)propanoylamino]butanoate |
|---|---|
| PubChem CID | 129092686 |
| Molecular Formula | C13H18N2O3S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | methyl 4-[3-(pyridin-2-yldisulfanyl)propanoylamino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CCSSc1ccccn1 |
| InChI | InChI=1S/C13H18N2O3S2/c1-18-13(17)6-4-9-14-11(16)7-10-19-20-12-5-2-3-8-15-12/h2-3,5,8H,4,6-7,9-10H2,1H3,(H,14,16) |
| InChIKey | HMYRVTYZOCXZOL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|