C21H36N2O2S2 — CID 123332520
N-(8-methoxy-3,3,6,6-tetramethyloctyl)-3-(pyridin-2-yldisulfanyl)propanamide (PubChem CID 123332520) has the molecular formula C21H36N2O2S2 and a molecular weight of 412.67 g/mol. Its IUPAC name is N-(8-methoxy-3,3,6,6-tetramethyloctyl)-3-(pyridin-2-yldisulfanyl)propanamide.
| Compound Name | N-(8-methoxy-3,3,6,6-tetramethyloctyl)-3-(pyridin-2-yldisulfanyl)propanamide |
|---|---|
| PubChem CID | 123332520 |
| Molecular Formula | C21H36N2O2S2 |
| Molecular Weight | 412.67 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-(8-methoxy-3,3,6,6-tetramethyloctyl)-3-(pyridin-2-yldisulfanyl)propanamide |
| SMILES | COCCC(C)(C)CCC(C)(C)CCNC(=O)CCSSc1ccccn1 |
| InChI | InChI=1S/C21H36N2O2S2/c1-20(2,10-11-21(3,4)13-16-25-5)12-15-22-18(24)9-17-26-27-19-8-6-7-14-23-19/h6-8,14H,9-13,15-17H2,1-5H3,(H,22,24) |
| InChIKey | AXDVRDJPRZJQAE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.67 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|