C21H27N3O2S4 — CID 58435587
N-[6-oxo-8-(pyridin-2-yldisulfanyl)octyl]-3-(pyridin-2-yldisulfanyl)propanamide (PubChem CID 58435587) has the molecular formula C21H27N3O2S4 and a molecular weight of 481.73 g/mol. Its IUPAC name is N-[6-oxo-8-(pyridin-2-yldisulfanyl)octyl]-3-(pyridin-2-yldisulfanyl)propanamide.
| Compound Name | N-[6-oxo-8-(pyridin-2-yldisulfanyl)octyl]-3-(pyridin-2-yldisulfanyl)propanamide |
|---|---|
| PubChem CID | 58435587 |
| Molecular Formula | C21H27N3O2S4 |
| Molecular Weight | 481.73 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | N-[6-oxo-8-(pyridin-2-yldisulfanyl)octyl]-3-(pyridin-2-yldisulfanyl)propanamide |
| SMILES | O=C(CCCCCNC(=O)CCSSc1ccccn1)CCSSc1ccccn1 |
| InChI | InChI=1S/C21H27N3O2S4/c25-18(11-16-27-29-20-9-3-6-14-23-20)8-2-1-5-13-22-19(26)12-17-28-30-21-10-4-7-15-24-21/h3-4,6-7,9-10,14-15H,1-2,5,8,11-13,16-17H2,(H,22,26) |
| InChIKey | XQVJXCMZIYONGJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.73 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|