C38H55N5O8S4 — CID 147631285
2-[2-[bis[2-[[8-oxo-10-(pyridin-2-yldisulfanyl)decanoyl]amino]ethyl]amino]-2-oxoethoxy]acetic acid (PubChem CID 147631285) has the molecular formula C38H55N5O8S4 and a molecular weight of 838.15 g/mol. Its IUPAC name is 2-[2-[bis[2-[[8-oxo-10-(pyridin-2-yldisulfanyl)decanoyl]amino]ethyl]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[bis[2-[[8-oxo-10-(pyridin-2-yldisulfanyl)decanoyl]amino]ethyl]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 147631285 |
| Molecular Formula | C38H55N5O8S4 |
| Molecular Weight | 838.15 g/mol |
| Exact Mass | 837.29 |
| IUPAC Name | 2-[2-[bis[2-[[8-oxo-10-(pyridin-2-yldisulfanyl)decanoyl]amino]ethyl]amino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)N(CCNC(=O)CCCCCCC(=O)CCSSc1ccccn1)CCNC(=O)CCCCCCC(=O)CCSSc1ccccn1 |
| InChI | InChI=1S/C38H55N5O8S4/c44-31(19-27-52-54-35-17-9-11-21-41-35)13-5-1-3-7-15-33(46)39-23-25-43(37(48)29-51-30-38(49)50)26-24-40-34(47)16-8-4-2-6-14-32(45)20-28-53-55-36-18-10-12-22-42-36/h9-12,17-18,21-22H,1-8,13-16,19-20,23-30H2,(H,39,46)(H,40,47)(H,49,50) |
| InChIKey | GFTSAUTVDOYRSJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 184.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.15 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|