C18H25N3O8S3 — CID 87318870
2,5-dioxopyrrolidine-3-sulfonic acid;6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoic acid (PubChem CID 87318870) has the molecular formula C18H25N3O8S3 and a molecular weight of 507.61 g/mol. Its IUPAC name is 2,5-dioxopyrrolidine-3-sulfonic acid;6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoic acid.
| Compound Name | 2,5-dioxopyrrolidine-3-sulfonic acid;6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 87318870 |
| Molecular Formula | C18H25N3O8S3 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 2,5-dioxopyrrolidine-3-sulfonic acid;6-[3-(pyridin-2-yldisulfanyl)propanoylamino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CCSSc1ccccn1.O=C1CC(S(=O)(=O)O)C(=O)N1 |
| InChI | InChI=1S/C14H20N2O3S2.C4H5NO5S/c17-12(15-9-4-1-2-7-14(18)19)8-11-20-21-13-6-3-5-10-16-13;6-3-1-2(4(7)5-3)11(8,9)10/h3,5-6,10H,1-2,4,7-9,11H2,(H,15,17)(H,18,19);2H,1H2,(H,5,6,7)(H,8,9,10) |
| InChIKey | ZAUXTIRLARWTHL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 179.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|