C12H17N2O5PS2 — CID 118426455
2-[carboxymethyl-[methyl-[2-(pyridin-2-yldisulfanyl)ethyl]amino]phosphoryl]acetic acid (PubChem CID 118426455) has the molecular formula C12H17N2O5PS2 and a molecular weight of 364.39 g/mol. Its IUPAC name is 2-[carboxymethyl-[methyl-[2-(pyridin-2-yldisulfanyl)ethyl]amino]phosphoryl]acetic acid.
| Compound Name | 2-[carboxymethyl-[methyl-[2-(pyridin-2-yldisulfanyl)ethyl]amino]phosphoryl]acetic acid |
|---|---|
| PubChem CID | 118426455 |
| Molecular Formula | C12H17N2O5PS2 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2-[carboxymethyl-[methyl-[2-(pyridin-2-yldisulfanyl)ethyl]amino]phosphoryl]acetic acid |
| SMILES | CN(CCSSc1ccccn1)P(=O)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C12H17N2O5PS2/c1-14(20(19,8-11(15)16)9-12(17)18)6-7-21-22-10-4-2-3-5-13-10/h2-5H,6-9H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | APKNDDXBZXEMCH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|