C16H25NO2S2 — CID 156791261
3-[3,3-dimethyl-4-(pyridin-2-yldisulfanyl)butoxy]-3-methylbutanal (PubChem CID 156791261) has the molecular formula C16H25NO2S2 and a molecular weight of 327.51 g/mol. Its IUPAC name is 3-[3,3-dimethyl-4-(pyridin-2-yldisulfanyl)butoxy]-3-methylbutanal.
| Compound Name | 3-[3,3-dimethyl-4-(pyridin-2-yldisulfanyl)butoxy]-3-methylbutanal |
|---|---|
| PubChem CID | 156791261 |
| Molecular Formula | C16H25NO2S2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-[3,3-dimethyl-4-(pyridin-2-yldisulfanyl)butoxy]-3-methylbutanal |
| SMILES | CC(C)(CCOC(C)(C)CC=O)CSSc1ccccn1 |
| InChI | InChI=1S/C16H25NO2S2/c1-15(2,9-12-19-16(3,4)8-11-18)13-20-21-14-7-5-6-10-17-14/h5-7,10-11H,8-9,12-13H2,1-4H3 |
| InChIKey | RXPMNKJBEIYUAC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|