C15H22N2OS2 — CID 129099202
N-cycloheptyl-3-(pyridin-2-yldisulfanyl)propanamide (PubChem CID 129099202) has the molecular formula C15H22N2OS2 and a molecular weight of 310.49 g/mol. Its IUPAC name is N-cycloheptyl-3-(pyridin-2-yldisulfanyl)propanamide.
| Compound Name | N-cycloheptyl-3-(pyridin-2-yldisulfanyl)propanamide |
|---|---|
| PubChem CID | 129099202 |
| Molecular Formula | C15H22N2OS2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-cycloheptyl-3-(pyridin-2-yldisulfanyl)propanamide |
| SMILES | O=C(CCSSc1ccccn1)NC1CCCCCC1 |
| InChI | InChI=1S/C15H22N2OS2/c18-14(17-13-7-3-1-2-4-8-13)10-12-19-20-15-9-5-6-11-16-15/h5-6,9,11,13H,1-4,7-8,10,12H2,(H,17,18) |
| InChIKey | VWLBIHSVDQZUDQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|