C26H29N5O2S2 — CID 142200515
6-pyridin-2-yl-N-[4-[4-(pyridin-2-yldisulfanyl)butanoylamino]cyclohexyl]pyridine-3-carboxamide (PubChem CID 142200515) has the molecular formula C26H29N5O2S2 and a molecular weight of 507.69 g/mol. Its IUPAC name is 6-pyridin-2-yl-N-[4-[4-(pyridin-2-yldisulfanyl)butanoylamino]cyclohexyl]pyridine-3-carboxamide.
| Compound Name | 6-pyridin-2-yl-N-[4-[4-(pyridin-2-yldisulfanyl)butanoylamino]cyclohexyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 142200515 |
| Molecular Formula | C26H29N5O2S2 |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 6-pyridin-2-yl-N-[4-[4-(pyridin-2-yldisulfanyl)butanoylamino]cyclohexyl]pyridine-3-carboxamide |
| SMILES | O=C(CCCSSc1ccccn1)NC1CCC(NC(=O)c2ccc(-c3ccccn3)nc2)CC1 |
| InChI | InChI=1S/C26H29N5O2S2/c32-24(7-5-17-34-35-25-8-2-4-16-28-25)30-20-10-12-21(13-11-20)31-26(33)19-9-14-23(29-18-19)22-6-1-3-15-27-22/h1-4,6,8-9,14-16,18,20-21H,5,7,10-13,17H2,(H,30,32)(H,31,33) |
| InChIKey | MJRCWKFSOLZKGI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|