C13H16ClN3O2 — CID 112731614
6-chloro-N-[4-(cyclopropylamino)-4-oxobutyl]pyridine-3-carboxamide (PubChem CID 112731614) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 6-chloro-N-[4-(cyclopropylamino)-4-oxobutyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[4-(cyclopropylamino)-4-oxobutyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 112731614 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 6-chloro-N-[4-(cyclopropylamino)-4-oxobutyl]pyridine-3-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)nc1)NC1CC1 |
| InChI | InChI=1S/C13H16ClN3O2/c14-11-6-3-9(8-16-11)13(19)15-7-1-2-12(18)17-10-4-5-10/h3,6,8,10H,1-2,4-5,7H2,(H,15,19)(H,17,18) |
| InChIKey | KYHUGLJQQNWERF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|