C20H29ClN4O2 — CID 46381858
6-chloro-N-[2-[1-(cyclohexylcarbamoyl)piperidin-4-yl]ethyl]pyridine-3-carboxamide (PubChem CID 46381858) has the molecular formula C20H29ClN4O2 and a molecular weight of 392.93 g/mol. Its IUPAC name is 6-chloro-N-[2-[1-(cyclohexylcarbamoyl)piperidin-4-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-[1-(cyclohexylcarbamoyl)piperidin-4-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46381858 |
| Molecular Formula | C20H29ClN4O2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 6-chloro-N-[2-[1-(cyclohexylcarbamoyl)piperidin-4-yl]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCC1CCN(C(=O)NC2CCCCC2)CC1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C20H29ClN4O2/c21-18-7-6-16(14-23-18)19(26)22-11-8-15-9-12-25(13-10-15)20(27)24-17-4-2-1-3-5-17/h6-7,14-15,17H,1-5,8-13H2,(H,22,26)(H,24,27) |
| InChIKey | YYKPSHGGAVEWOE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|