C18H25ClN4O2 — CID 75626484
N-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-ylamino)-4-oxobutyl]-4-chlorobenzamide (PubChem CID 75626484) has the molecular formula C18H25ClN4O2 and a molecular weight of 364.88 g/mol. Its IUPAC name is N-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-ylamino)-4-oxobutyl]-4-chlorobenzamide.
| Compound Name | N-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-ylamino)-4-oxobutyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 75626484 |
| Molecular Formula | C18H25ClN4O2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | N-[4-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-ylamino)-4-oxobutyl]-4-chlorobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)NC1CCC2NNCC2C1 |
| InChI | InChI=1S/C18H25ClN4O2/c19-14-5-3-12(4-6-14)18(25)20-9-1-2-17(24)22-15-7-8-16-13(10-15)11-21-23-16/h3-6,13,15-16,21,23H,1-2,7-11H2,(H,20,25)(H,22,24) |
| InChIKey | UEWBXQAGBLJXEV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|