C16H21ClN2O2 — CID 4822526
4-chloro-N-[3-(cyclohexylamino)-3-oxopropyl]benzamide (PubChem CID 4822526) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 4-chloro-N-[3-(cyclohexylamino)-3-oxopropyl]benzamide.
| Compound Name | 4-chloro-N-[3-(cyclohexylamino)-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 4822526 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-chloro-N-[3-(cyclohexylamino)-3-oxopropyl]benzamide |
| SMILES | O=C(CCNC(=O)c1ccc(Cl)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C16H21ClN2O2/c17-13-8-6-12(7-9-13)16(21)18-11-10-15(20)19-14-4-2-1-3-5-14/h6-9,14H,1-5,10-11H2,(H,18,21)(H,19,20) |
| InChIKey | HKUKXUGKWXXGLE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |