C16H24ClIN4O — CID 111042945
N-[2-[[amino-(cyclohexylamino)methylidene]amino]ethyl]-4-chlorobenzamide;hydroiodide (PubChem CID 111042945) has the molecular formula C16H24ClIN4O and a molecular weight of 450.75 g/mol. Its IUPAC name is N-[2-[[amino-(cyclohexylamino)methylidene]amino]ethyl]-4-chlorobenzamide;hydroiodide.
| Compound Name | N-[2-[[amino-(cyclohexylamino)methylidene]amino]ethyl]-4-chlorobenzamide;hydroiodide |
|---|---|
| PubChem CID | 111042945 |
| Molecular Formula | C16H24ClIN4O |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N-[2-[[amino-(cyclohexylamino)methylidene]amino]ethyl]-4-chlorobenzamide;hydroiodide |
| SMILES | I.N/C(=N\CCNC(=O)c1ccc(Cl)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C16H23ClN4O.HI/c17-13-8-6-12(7-9-13)15(22)19-10-11-20-16(18)21-14-4-2-1-3-5-14;/h6-9,14H,1-5,10-11H2,(H,19,22)(H3,18,20,21);1H |
| InChIKey | RHBOTKGMVOCXQT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|