C16H23FN4O — CID 111075647
N-[2-[[amino-(cyclohexylamino)methylidene]amino]ethyl]-2-fluorobenzamide (PubChem CID 111075647) has the molecular formula C16H23FN4O and a molecular weight of 306.38 g/mol. Its IUPAC name is N-[2-[[amino-(cyclohexylamino)methylidene]amino]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[[amino-(cyclohexylamino)methylidene]amino]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 111075647 |
| Molecular Formula | C16H23FN4O |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[2-[[amino-(cyclohexylamino)methylidene]amino]ethyl]-2-fluorobenzamide |
| SMILES | N/C(=N\CCNC(=O)c1ccccc1F)NC1CCCCC1 |
| InChI | InChI=1S/C16H23FN4O/c17-14-9-5-4-8-13(14)15(22)19-10-11-20-16(18)21-12-6-2-1-3-7-12/h4-5,8-9,12H,1-3,6-7,10-11H2,(H,19,22)(H3,18,20,21) |
| InChIKey | RXYKJQOMKZKFOZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|