C13H18FIN4O — CID 110917991
N-[2-[[amino-(cyclopropylamino)methylidene]amino]ethyl]-2-fluorobenzamide;hydroiodide (PubChem CID 110917991) has the molecular formula C13H18FIN4O and a molecular weight of 392.22 g/mol. Its IUPAC name is N-[2-[[amino-(cyclopropylamino)methylidene]amino]ethyl]-2-fluorobenzamide;hydroiodide.
| Compound Name | N-[2-[[amino-(cyclopropylamino)methylidene]amino]ethyl]-2-fluorobenzamide;hydroiodide |
|---|---|
| PubChem CID | 110917991 |
| Molecular Formula | C13H18FIN4O |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-[2-[[amino-(cyclopropylamino)methylidene]amino]ethyl]-2-fluorobenzamide;hydroiodide |
| SMILES | I.N/C(=N\CCNC(=O)c1ccccc1F)NC1CC1 |
| InChI | InChI=1S/C13H17FN4O.HI/c14-11-4-2-1-3-10(11)12(19)16-7-8-17-13(15)18-9-5-6-9;/h1-4,9H,5-8H2,(H,16,19)(H3,15,17,18);1H |
| InChIKey | JYHGFUDFEJOMDV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|