C16H19Cl2FN2O2 — CID 60552301
2,4-dichloro-N-[3-(cyclohexylamino)-3-oxopropyl]-5-fluorobenzamide (PubChem CID 60552301) has the molecular formula C16H19Cl2FN2O2 and a molecular weight of 361.24 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-(cyclohexylamino)-3-oxopropyl]-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-[3-(cyclohexylamino)-3-oxopropyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 60552301 |
| Molecular Formula | C16H19Cl2FN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2,4-dichloro-N-[3-(cyclohexylamino)-3-oxopropyl]-5-fluorobenzamide |
| SMILES | O=C(CCNC(=O)c1cc(F)c(Cl)cc1Cl)NC1CCCCC1 |
| InChI | InChI=1S/C16H19Cl2FN2O2/c17-12-9-13(18)14(19)8-11(12)16(23)20-7-6-15(22)21-10-4-2-1-3-5-10/h8-10H,1-7H2,(H,20,23)(H,21,22) |
| InChIKey | GLOICHPTHTUNJZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|