C16H22ClFN2O — CID 81486156
5-chloro-N-[2-(cycloheptylamino)ethyl]-2-fluorobenzamide (PubChem CID 81486156) has the molecular formula C16H22ClFN2O and a molecular weight of 312.82 g/mol. Its IUPAC name is 5-chloro-N-[2-(cycloheptylamino)ethyl]-2-fluorobenzamide.
| Compound Name | 5-chloro-N-[2-(cycloheptylamino)ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 81486156 |
| Molecular Formula | C16H22ClFN2O |
| Molecular Weight | 312.82 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5-chloro-N-[2-(cycloheptylamino)ethyl]-2-fluorobenzamide |
| SMILES | O=C(NCCNC1CCCCCC1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C16H22ClFN2O/c17-12-7-8-15(18)14(11-12)16(21)20-10-9-19-13-5-3-1-2-4-6-13/h7-8,11,13,19H,1-6,9-10H2,(H,20,21) |
| InChIKey | GPBRDQZTFJWDSK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.82 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|