C17H26Cl2N2OS — CID 119620649
2-chloro-N-[2-(cycloheptylamino)ethyl]-5-methylsulfanylbenzamide;hydrochloride (PubChem CID 119620649) has the molecular formula C17H26Cl2N2OS and a molecular weight of 377.38 g/mol. Its IUPAC name is 2-chloro-N-[2-(cycloheptylamino)ethyl]-5-methylsulfanylbenzamide;hydrochloride.
| Compound Name | 2-chloro-N-[2-(cycloheptylamino)ethyl]-5-methylsulfanylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119620649 |
| Molecular Formula | C17H26Cl2N2OS |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-chloro-N-[2-(cycloheptylamino)ethyl]-5-methylsulfanylbenzamide;hydrochloride |
| SMILES | CSc1ccc(Cl)c(C(=O)NCCNC2CCCCCC2)c1.Cl |
| InChI | InChI=1S/C17H25ClN2OS.ClH/c1-22-14-8-9-16(18)15(12-14)17(21)20-11-10-19-13-6-4-2-3-5-7-13;/h8-9,12-13,19H,2-7,10-11H2,1H3,(H,20,21);1H |
| InChIKey | LFQAQTTXBFBZHY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|