C16H23ClF2N2O — CID 119620646
N-[2-(cycloheptylamino)ethyl]-2,4-difluorobenzamide;hydrochloride (PubChem CID 119620646) has the molecular formula C16H23ClF2N2O and a molecular weight of 332.82 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2,4-difluorobenzamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2,4-difluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119620646 |
| Molecular Formula | C16H23ClF2N2O |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2,4-difluorobenzamide;hydrochloride |
| SMILES | Cl.O=C(NCCNC1CCCCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H22F2N2O.ClH/c17-12-7-8-14(15(18)11-12)16(21)20-10-9-19-13-5-3-1-2-4-6-13;/h7-8,11,13,19H,1-6,9-10H2,(H,20,21);1H |
| InChIKey | LAIMUHNEGUEOME-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|