C16H23F2N3O3S — CID 51130080
N-[2-[[cyclohexyl(methyl)sulfamoyl]amino]ethyl]-2,4-difluorobenzamide (PubChem CID 51130080) has the molecular formula C16H23F2N3O3S and a molecular weight of 375.44 g/mol. Its IUPAC name is N-[2-[[cyclohexyl(methyl)sulfamoyl]amino]ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-[[cyclohexyl(methyl)sulfamoyl]amino]ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 51130080 |
| Molecular Formula | C16H23F2N3O3S |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[2-[[cyclohexyl(methyl)sulfamoyl]amino]ethyl]-2,4-difluorobenzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)NCCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2N3O3S/c1-21(13-5-3-2-4-6-13)25(23,24)20-10-9-19-16(22)14-8-7-12(17)11-15(14)18/h7-8,11,13,20H,2-6,9-10H2,1H3,(H,19,22) |
| InChIKey | MIVWIHBDHLJMJX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|