C17H21F2NO4 — CID 86920097
(3-methoxycyclohexyl) 3-[(2,4-difluorobenzoyl)amino]propanoate (PubChem CID 86920097) has the molecular formula C17H21F2NO4 and a molecular weight of 341.35 g/mol. Its IUPAC name is (3-methoxycyclohexyl) 3-[(2,4-difluorobenzoyl)amino]propanoate.
| Compound Name | (3-methoxycyclohexyl) 3-[(2,4-difluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 86920097 |
| Molecular Formula | C17H21F2NO4 |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (3-methoxycyclohexyl) 3-[(2,4-difluorobenzoyl)amino]propanoate |
| SMILES | COC1CCCC(OC(=O)CCNC(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C17H21F2NO4/c1-23-12-3-2-4-13(10-12)24-16(21)7-8-20-17(22)14-6-5-11(18)9-15(14)19/h5-6,9,12-13H,2-4,7-8,10H2,1H3,(H,20,22) |
| InChIKey | BZIPXPJHERTJCG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |