C17H22F2N2O2 — CID 51192558
N-[3-(2-ethylpiperidin-1-yl)-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 51192558) has the molecular formula C17H22F2N2O2 and a molecular weight of 324.37 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 51192558 |
| Molecular Formula | C17H22F2N2O2 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | CCC1CCCCN1C(=O)CCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H22F2N2O2/c1-2-13-5-3-4-10-21(13)16(22)8-9-20-17(23)14-7-6-12(18)11-15(14)19/h6-7,11,13H,2-5,8-10H2,1H3,(H,20,23) |
| InChIKey | QPFYSKBTXSNXSL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |