C11H15F2N3O3S — CID 51102133
N-[2-(dimethylsulfamoylamino)ethyl]-2,4-difluorobenzamide (PubChem CID 51102133) has the molecular formula C11H15F2N3O3S and a molecular weight of 307.32 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoylamino)ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-(dimethylsulfamoylamino)ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 51102133 |
| Molecular Formula | C11H15F2N3O3S |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-[2-(dimethylsulfamoylamino)ethyl]-2,4-difluorobenzamide |
| SMILES | CN(C)S(=O)(=O)NCCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H15F2N3O3S/c1-16(2)20(18,19)15-6-5-14-11(17)9-4-3-8(12)7-10(9)13/h3-4,7,15H,5-6H2,1-2H3,(H,14,17) |
| InChIKey | NQTCCRGTHMSHAC-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|