C10H14F2N2O2S — CID 110789026
1-[2-(dimethylsulfamoylamino)ethyl]-2,4-difluorobenzene (PubChem CID 110789026) has the molecular formula C10H14F2N2O2S and a molecular weight of 264.30 g/mol. Its IUPAC name is 1-[2-(dimethylsulfamoylamino)ethyl]-2,4-difluorobenzene.
| Compound Name | 1-[2-(dimethylsulfamoylamino)ethyl]-2,4-difluorobenzene |
|---|---|
| PubChem CID | 110789026 |
| Molecular Formula | C10H14F2N2O2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-[2-(dimethylsulfamoylamino)ethyl]-2,4-difluorobenzene |
| SMILES | CN(C)S(=O)(=O)NCCc1ccc(F)cc1F |
| InChI | InChI=1S/C10H14F2N2O2S/c1-14(2)17(15,16)13-6-5-8-3-4-9(11)7-10(8)12/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | KAACZSFJGMUQIX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |