C11H12ClF2NO — CID 115162195
2-chloro-N-[2-(2,4-difluorophenyl)ethyl]-N-methylacetamide (PubChem CID 115162195) has the molecular formula C11H12ClF2NO and a molecular weight of 247.67 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,4-difluorophenyl)ethyl]-N-methylacetamide.
| Compound Name | 2-chloro-N-[2-(2,4-difluorophenyl)ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 115162195 |
| Molecular Formula | C11H12ClF2NO |
| Molecular Weight | 247.67 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-chloro-N-[2-(2,4-difluorophenyl)ethyl]-N-methylacetamide |
| SMILES | CN(CCc1ccc(F)cc1F)C(=O)CCl |
| InChI | InChI=1S/C11H12ClF2NO/c1-15(11(16)7-12)5-4-8-2-3-9(13)6-10(8)14/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | HMWHJBZFHICPRX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.67 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|