C11H13F2NOS — CID 115167494
N-[2-(2,4-difluorophenyl)ethyl]-N-methyl-2-sulfanylacetamide (PubChem CID 115167494) has the molecular formula C11H13F2NOS and a molecular weight of 245.29 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)ethyl]-N-methyl-2-sulfanylacetamide.
| Compound Name | N-[2-(2,4-difluorophenyl)ethyl]-N-methyl-2-sulfanylacetamide |
|---|---|
| PubChem CID | 115167494 |
| Molecular Formula | C11H13F2NOS |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)ethyl]-N-methyl-2-sulfanylacetamide |
| SMILES | CN(CCc1ccc(F)cc1F)C(=O)CS |
| InChI | InChI=1S/C11H13F2NOS/c1-14(11(15)7-16)5-4-8-2-3-9(12)6-10(8)13/h2-3,6,16H,4-5,7H2,1H3 |
| InChIKey | JETADVUWQRCMSG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|