C10H10ClF2NO — CID 115195055
N-[2-(2,4-difluorophenyl)ethyl]-N-methylcarbamoyl chloride (PubChem CID 115195055) has the molecular formula C10H10ClF2NO and a molecular weight of 233.65 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)ethyl]-N-methylcarbamoyl chloride.
| Compound Name | N-[2-(2,4-difluorophenyl)ethyl]-N-methylcarbamoyl chloride |
|---|---|
| PubChem CID | 115195055 |
| Molecular Formula | C10H10ClF2NO |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)ethyl]-N-methylcarbamoyl chloride |
| SMILES | CN(CCc1ccc(F)cc1F)C(=O)Cl |
| InChI | InChI=1S/C10H10ClF2NO/c1-14(10(11)15)5-4-7-2-3-8(12)6-9(7)13/h2-3,6H,4-5H2,1H3 |
| InChIKey | IEKAGRYSZKNBIZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|