C17H25ClF2N2O2 — CID 119619857
N-[2-(cycloheptylamino)ethyl]-2-(2,4-difluorophenoxy)acetamide;hydrochloride (PubChem CID 119619857) has the molecular formula C17H25ClF2N2O2 and a molecular weight of 362.85 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2-(2,4-difluorophenoxy)acetamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2-(2,4-difluorophenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119619857 |
| Molecular Formula | C17H25ClF2N2O2 |
| Molecular Weight | 362.85 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2-(2,4-difluorophenoxy)acetamide;hydrochloride |
| SMILES | Cl.O=C(COc1ccc(F)cc1F)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C17H24F2N2O2.ClH/c18-13-7-8-16(15(19)11-13)23-12-17(22)21-10-9-20-14-5-3-1-2-4-6-14;/h7-8,11,14,20H,1-6,9-10,12H2,(H,21,22);1H |
| InChIKey | RPZFTNYVPNADMY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|