C11H11F2NO4 — CID 43170635
3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid (PubChem CID 43170635) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43170635 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)COc1ccc(F)cc1F |
| InChI | InChI=1S/C11H11F2NO4/c12-7-1-2-9(8(13)5-7)18-6-10(15)14-4-3-11(16)17/h1-2,5H,3-4,6H2,(H,14,15)(H,16,17) |
| InChIKey | BEURPCKKXYVNRS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |