3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid

C11H11F2NO4 — CID 43170635

IUPAC3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid
SMILESO=C(O)CCNC(=O)COc1ccc(F)cc1F
InChIInChI=1S/C11H11F2NO4/c12-7-1-2-9(8(13)5-7)18-6-10(15)14-4-3-11(16)17/h1-2,5H,3-4,6H2,(H,14,15)(H,16,17)
InChIKeyBEURPCKKXYVNRS-UHFFFAOYSA-N
MW259.21 g/mol
LogP0.93
Rot. Bonds6

About 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid

3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid (PubChem CID 43170635) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid.

Molecular Properties

Compound Name3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid
PubChem CID43170635
Molecular FormulaC11H11F2NO4
Molecular Weight259.21 g/mol
Exact Mass259.07
IUPAC Name3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid
SMILESO=C(O)CCNC(=O)COc1ccc(F)cc1F
InChIInChI=1S/C11H11F2NO4/c12-7-1-2-9(8(13)5-7)18-6-10(15)14-4-3-11(16)17/h1-2,5H,3-4,6H2,(H,14,15)(H,16,17)
InChIKeyBEURPCKKXYVNRS-UHFFFAOYSA-N
XLogP0.93
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.21
LogP ≤ 50.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid?
The IUPAC name of 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid (CID 43170635) is 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid.
What is the SMILES notation for 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid?
The canonical SMILES for 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid is O=C(O)CCNC(=O)COc1ccc(F)cc1F.
What is the InChIKey of 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid?
The InChIKey is BEURPCKKXYVNRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO4/c12-7-1-2-9(8(13)5-7)18-6-10(15)14-4-3-11(16)17/h1-2,5H,3-4,6H2,(H,14,15)(H,16,17).
What are the key properties of 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid?
3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid has a molecular weight of 259.21 g/mol, XLogP of 0.93, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(2,4-difluorophenoxy)acetyl]amino]propanoic acid is sourced from PubChem (CID 43170635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).