C14H12F2N2O2 — CID 25236315
2-(2,4-difluorophenoxy)-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 25236315) has the molecular formula C14H12F2N2O2 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-(2,4-difluorophenoxy)-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 25236315 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | O=C(COc1ccc(F)cc1F)NCc1ccncc1 |
| InChI | InChI=1S/C14H12F2N2O2/c15-11-1-2-13(12(16)7-11)20-9-14(19)18-8-10-3-5-17-6-4-10/h1-7H,8-9H2,(H,18,19) |
| InChIKey | OIXWRHHVNFTGFZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |