C10H9F2NO4 — CID 82294566
3-[(2,4-difluorophenoxy)carbonylamino]propanoic acid (PubChem CID 82294566) has the molecular formula C10H9F2NO4 and a molecular weight of 245.18 g/mol. Its IUPAC name is 3-[(2,4-difluorophenoxy)carbonylamino]propanoic acid.
| Compound Name | 3-[(2,4-difluorophenoxy)carbonylamino]propanoic acid |
|---|---|
| PubChem CID | 82294566 |
| Molecular Formula | C10H9F2NO4 |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-[(2,4-difluorophenoxy)carbonylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C10H9F2NO4/c11-6-1-2-8(7(12)5-6)17-10(16)13-4-3-9(14)15/h1-2,5H,3-4H2,(H,13,16)(H,14,15) |
| InChIKey | KUVKRGWXXINKJG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |