C15H18F2N2O4 — CID 122019186
3-[[4-(2,4-difluorophenoxy)piperidine-1-carbonyl]amino]propanoic acid (PubChem CID 122019186) has the molecular formula C15H18F2N2O4 and a molecular weight of 328.31 g/mol. Its IUPAC name is 3-[[4-(2,4-difluorophenoxy)piperidine-1-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[4-(2,4-difluorophenoxy)piperidine-1-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122019186 |
| Molecular Formula | C15H18F2N2O4 |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 3-[[4-(2,4-difluorophenoxy)piperidine-1-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)N1CCC(Oc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C15H18F2N2O4/c16-10-1-2-13(12(17)9-10)23-11-4-7-19(8-5-11)15(22)18-6-3-14(20)21/h1-2,9,11H,3-8H2,(H,18,22)(H,20,21) |
| InChIKey | CNOLCEOEDCSTEJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |