C16H20F2N2O2 — CID 124698879
[4-(2,4-difluorophenoxy)piperidin-1-yl]-[(2R)-pyrrolidin-2-yl]methanone (PubChem CID 124698879) has the molecular formula C16H20F2N2O2 and a molecular weight of 310.34 g/mol. Its IUPAC name is [4-(2,4-difluorophenoxy)piperidin-1-yl]-[(2R)-pyrrolidin-2-yl]methanone.
| Compound Name | [4-(2,4-difluorophenoxy)piperidin-1-yl]-[(2R)-pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 124698879 |
| Molecular Formula | C16H20F2N2O2 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [4-(2,4-difluorophenoxy)piperidin-1-yl]-[(2R)-pyrrolidin-2-yl]methanone |
| SMILES | O=C([C@H]1CCCN1)N1CCC(Oc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C16H20F2N2O2/c17-11-3-4-15(13(18)10-11)22-12-5-8-20(9-6-12)16(21)14-2-1-7-19-14/h3-4,10,12,14,19H,1-2,5-9H2/t14-/m1/s1 |
| InChIKey | JUAOMQJIPREVEI-CQSZACIVSA-N |
| XLogP | 2.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |