C16H20F2N2O3 — CID 119736591
[4-(2,4-difluorophenoxy)piperidin-1-yl]-morpholin-2-ylmethanone (PubChem CID 119736591) has the molecular formula C16H20F2N2O3 and a molecular weight of 326.34 g/mol. Its IUPAC name is [4-(2,4-difluorophenoxy)piperidin-1-yl]-morpholin-2-ylmethanone.
| Compound Name | [4-(2,4-difluorophenoxy)piperidin-1-yl]-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 119736591 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [4-(2,4-difluorophenoxy)piperidin-1-yl]-morpholin-2-ylmethanone |
| SMILES | O=C(C1CNCCO1)N1CCC(Oc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C16H20F2N2O3/c17-11-1-2-14(13(18)9-11)23-12-3-6-20(7-4-12)16(21)15-10-19-5-8-22-15/h1-2,9,12,15,19H,3-8,10H2 |
| InChIKey | UYKDSRFLEYHYPP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |