C17H21FN2O2 — CID 50852464
(4-fluorophenyl)-[1-(pyrrolidine-2-carbonyl)piperidin-4-yl]methanone (PubChem CID 50852464) has the molecular formula C17H21FN2O2 and a molecular weight of 304.36 g/mol. Its IUPAC name is (4-fluorophenyl)-[1-(pyrrolidine-2-carbonyl)piperidin-4-yl]methanone.
| Compound Name | (4-fluorophenyl)-[1-(pyrrolidine-2-carbonyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 50852464 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (4-fluorophenyl)-[1-(pyrrolidine-2-carbonyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(C(=O)C2CCCN2)CC1 |
| InChI | InChI=1S/C17H21FN2O2/c18-14-5-3-12(4-6-14)16(21)13-7-10-20(11-8-13)17(22)15-2-1-9-19-15/h3-6,13,15,19H,1-2,7-11H2 |
| InChIKey | IJEJPEPGBIXYKI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |