C15H11F2NO3 — CID 58981575
(2,4-difluorophenyl) 2-(benzylamino)-2-oxoacetate (PubChem CID 58981575) has the molecular formula C15H11F2NO3 and a molecular weight of 291.25 g/mol. Its IUPAC name is (2,4-difluorophenyl) 2-(benzylamino)-2-oxoacetate.
| Compound Name | (2,4-difluorophenyl) 2-(benzylamino)-2-oxoacetate |
|---|---|
| PubChem CID | 58981575 |
| Molecular Formula | C15H11F2NO3 |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (2,4-difluorophenyl) 2-(benzylamino)-2-oxoacetate |
| SMILES | O=C(NCc1ccccc1)C(=O)Oc1ccc(F)cc1F |
| InChI | InChI=1S/C15H11F2NO3/c16-11-6-7-13(12(17)8-11)21-15(20)14(19)18-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,18,19) |
| InChIKey | PTFCSBAHVJTWFX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|