C12H13BrFNO4 — CID 43239243
4-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]butanoic acid (PubChem CID 43239243) has the molecular formula C12H13BrFNO4 and a molecular weight of 334.14 g/mol. Its IUPAC name is 4-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43239243 |
| Molecular Formula | C12H13BrFNO4 |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 4-[[2-(2-bromo-4-fluorophenoxy)acetyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)COc1ccc(F)cc1Br |
| InChI | InChI=1S/C12H13BrFNO4/c13-9-6-8(14)3-4-10(9)19-7-11(16)15-5-1-2-12(17)18/h3-4,6H,1-2,5,7H2,(H,15,16)(H,17,18) |
| InChIKey | BEBNTJDHJXSMRA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|