C16H22BrFN2O — CID 115306485
4-bromo-N-[2-(cycloheptylamino)ethyl]-3-fluorobenzamide (PubChem CID 115306485) has the molecular formula C16H22BrFN2O and a molecular weight of 357.27 g/mol. Its IUPAC name is 4-bromo-N-[2-(cycloheptylamino)ethyl]-3-fluorobenzamide.
| Compound Name | 4-bromo-N-[2-(cycloheptylamino)ethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 115306485 |
| Molecular Formula | C16H22BrFN2O |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 4-bromo-N-[2-(cycloheptylamino)ethyl]-3-fluorobenzamide |
| SMILES | O=C(NCCNC1CCCCCC1)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C16H22BrFN2O/c17-14-8-7-12(11-15(14)18)16(21)20-10-9-19-13-5-3-1-2-4-6-13/h7-8,11,13,19H,1-6,9-10H2,(H,20,21) |
| InChIKey | CNEXDNKQWOYMLS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|