C16H23IN2O — CID 115306464
N-[2-(cycloheptylamino)ethyl]-4-iodobenzamide (PubChem CID 115306464) has the molecular formula C16H23IN2O and a molecular weight of 386.28 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-4-iodobenzamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 115306464 |
| Molecular Formula | C16H23IN2O |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-4-iodobenzamide |
| SMILES | O=C(NCCNC1CCCCCC1)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H23IN2O/c17-14-9-7-13(8-10-14)16(20)19-12-11-18-15-5-3-1-2-4-6-15/h7-10,15,18H,1-6,11-12H2,(H,19,20) |
| InChIKey | UFQCDJIPZLUELW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|