C15H18N2O4S2 — CID 174349677
(2,5-dioxopyrrolidin-1-yl) 3-[(4-propyl-2-pyridinyl)disulfanyl]propanoate (PubChem CID 174349677) has the molecular formula C15H18N2O4S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[(4-propyl-2-pyridinyl)disulfanyl]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[(4-propyl-2-pyridinyl)disulfanyl]propanoate |
|---|---|
| PubChem CID | 174349677 |
| Molecular Formula | C15H18N2O4S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[(4-propyl-2-pyridinyl)disulfanyl]propanoate |
| SMILES | CCCc1ccnc(SSCCC(=O)ON2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C15H18N2O4S2/c1-2-3-11-6-8-16-12(10-11)23-22-9-7-15(20)21-17-13(18)4-5-14(17)19/h6,8,10H,2-5,7,9H2,1H3 |
| InChIKey | IAYQLCAOHGQIIR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|