C11H15NO5S — CID 90193619
(2,5-dioxopyrrolidin-1-yl) 4-oxo-4-propylsulfanylbutanoate (PubChem CID 90193619) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-oxo-4-propylsulfanylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-oxo-4-propylsulfanylbutanoate |
|---|---|
| PubChem CID | 90193619 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-oxo-4-propylsulfanylbutanoate |
| SMILES | CCCSC(=O)CCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H15NO5S/c1-2-7-18-11(16)6-5-10(15)17-12-8(13)3-4-9(12)14/h2-7H2,1H3 |
| InChIKey | MSQOEWZGRCWYBQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|