C14H15NO5 — CID 15690079
(2,5-dioxopyrrolidin-1-yl) 3-(4-methoxyphenyl)propanoate (PubChem CID 15690079) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(4-methoxyphenyl)propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 15690079 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)ON2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C14H15NO5/c1-19-11-5-2-10(3-6-11)4-9-14(18)20-15-12(16)7-8-13(15)17/h2-3,5-6H,4,7-9H2,1H3 |
| InChIKey | ZBTWSFHDZGKKEZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|