C19H23N5O9S3 — CID 174236114
1-[(4-azido-2-hydroxybenzoyl)amino]-1-(2,5-dioxopyrrolidin-1-yl)-2-propanethioyloxyethanesulfonic acid;propanethioic S-acid (PubChem CID 174236114) has the molecular formula C19H23N5O9S3 and a molecular weight of 561.62 g/mol. Its IUPAC name is 1-[(4-azido-2-hydroxybenzoyl)amino]-1-(2,5-dioxopyrrolidin-1-yl)-2-propanethioyloxyethanesulfonic acid;propanethioic S-acid.
| Compound Name | 1-[(4-azido-2-hydroxybenzoyl)amino]-1-(2,5-dioxopyrrolidin-1-yl)-2-propanethioyloxyethanesulfonic acid;propanethioic S-acid |
|---|---|
| PubChem CID | 174236114 |
| Molecular Formula | C19H23N5O9S3 |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.07 |
| IUPAC Name | 1-[(4-azido-2-hydroxybenzoyl)amino]-1-(2,5-dioxopyrrolidin-1-yl)-2-propanethioyloxyethanesulfonic acid;propanethioic S-acid |
| SMILES | CCC(=O)S.CCC(=S)OCC(NC(=O)c1ccc(N=[N+]=[N-])cc1O)(N1C(=O)CCC1=O)S(=O)(=O)O |
| InChI | InChI=1S/C16H17N5O8S2.C3H6OS/c1-2-14(30)29-8-16(31(26,27)28,21-12(23)5-6-13(21)24)18-15(25)10-4-3-9(19-20-17)7-11(10)22;1-2-3(4)5/h3-4,7,22H,2,5-6,8H2,1H3,(H,18,25)(H,26,27,28);2H2,1H3,(H,4,5) |
| InChIKey | KAEWXJCZVJNGDS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 216.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|