C11H12N4O5 — CID 90332849
(2S,3R)-2-[(4-azido-2-hydroxybenzoyl)amino]-3-hydroxybutanoic acid (PubChem CID 90332849) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is (2S,3R)-2-[(4-azido-2-hydroxybenzoyl)amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[(4-azido-2-hydroxybenzoyl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 90332849 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (2S,3R)-2-[(4-azido-2-hydroxybenzoyl)amino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(N=[N+]=[N-])cc1O)C(=O)O |
| InChI | InChI=1S/C11H12N4O5/c1-5(16)9(11(19)20)13-10(18)7-3-2-6(14-15-12)4-8(7)17/h2-5,9,16-17H,1H3,(H,13,18)(H,19,20)/t5-,9+/m1/s1 |
| InChIKey | DXLXJNJDUBYVFO-ANLVUFKYSA-N |
| XLogP | 0.90 |
| TPSA | 155.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|