C23H30N8O7 — CID 11706419
tert-butyl (2S,4R)-2-[[(3R)-1-(2-amino-2-oxoethyl)-2-oxopyrrolidin-3-yl]carbamoyl]-4-[(4-azido-2-hydroxybenzoyl)amino]pyrrolidine-1-carboxylate (PubChem CID 11706419) has the molecular formula C23H30N8O7 and a molecular weight of 530.54 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[[(3R)-1-(2-amino-2-oxoethyl)-2-oxopyrrolidin-3-yl]carbamoyl]-4-[(4-azido-2-hydroxybenzoyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[[(3R)-1-(2-amino-2-oxoethyl)-2-oxopyrrolidin-3-yl]carbamoyl]-4-[(4-azido-2-hydroxybenzoyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11706419 |
| Molecular Formula | C23H30N8O7 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | tert-butyl (2S,4R)-2-[[(3R)-1-(2-amino-2-oxoethyl)-2-oxopyrrolidin-3-yl]carbamoyl]-4-[(4-azido-2-hydroxybenzoyl)amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](NC(=O)c2ccc(N=[N+]=[N-])cc2O)C[C@H]1C(=O)N[C@@H]1CCN(CC(N)=O)C1=O |
| InChI | InChI=1S/C23H30N8O7/c1-23(2,3)38-22(37)31-10-13(26-19(34)14-5-4-12(28-29-25)9-17(14)32)8-16(31)20(35)27-15-6-7-30(21(15)36)11-18(24)33/h4-5,9,13,15-16,32H,6-8,10-11H2,1-3H3,(H2,24,33)(H,26,34)(H,27,35)/t13-,15-,16+/m1/s1 |
| InChIKey | XWMYGSOJMJQGSX-BMFZPTHFSA-N |
| XLogP | 0.64 |
| TPSA | 220.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|